C16H26O2Si — CID 11334947
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylpropanal (PubChem CID 11334947) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylpropanal.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylpropanal |
|---|---|
| PubChem CID | 11334947 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylpropanal |
| SMILES | CC(C=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H26O2Si/c1-13(12-17)15(14-10-8-7-9-11-14)18-19(5,6)16(2,3)4/h7-13,15H,1-6H3/t13?,15-/m0/s1 |
| InChIKey | AKHQNRWSLZLFOP-WUJWULDRSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|