C16H24O4 — CID 11334997
5-(2-methylpropyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxolane-2,4-dione (PubChem CID 11334997) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxolane-2,4-dione.
| Compound Name | 5-(2-methylpropyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11334997 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-(2-methylpropyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxolane-2,4-dione |
| SMILES | CC(C)CC1OC(=O)C(C(=O)C2C(C)(C)C2(C)C)C1=O |
| InChI | InChI=1S/C16H24O4/c1-8(2)7-9-11(17)10(14(19)20-9)12(18)13-15(3,4)16(13,5)6/h8-10,13H,7H2,1-6H3 |
| InChIKey | ZGOREARTLBLKIS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|