C12H13IN2O4 — CID 113352898
3-[[2-[acetyl(methyl)amino]acetyl]amino]-5-iodobenzoic acid (PubChem CID 113352898) has the molecular formula C12H13IN2O4 and a molecular weight of 376.15 g/mol. Its IUPAC name is 3-[[2-[acetyl(methyl)amino]acetyl]amino]-5-iodobenzoic acid.
| Compound Name | 3-[[2-[acetyl(methyl)amino]acetyl]amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 113352898 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 3-[[2-[acetyl(methyl)amino]acetyl]amino]-5-iodobenzoic acid |
| SMILES | CC(=O)N(C)CC(=O)Nc1cc(I)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H13IN2O4/c1-7(16)15(2)6-11(17)14-10-4-8(12(18)19)3-9(13)5-10/h3-5H,6H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | UQMKNPXCINGHEX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|