C12H26N2O4S — CID 113353089
(2R)-2-(dipropylsulfamoylamino)-3,3-dimethylbutanoic acid (PubChem CID 113353089) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2R)-2-(dipropylsulfamoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-(dipropylsulfamoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 113353089 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2R)-2-(dipropylsulfamoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)N[C@@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O4S/c1-6-8-14(9-7-2)19(17,18)13-10(11(15)16)12(3,4)5/h10,13H,6-9H2,1-5H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | YDQFCCLLUPEZOZ-JTQLQIEISA-N |
| XLogP | 1.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |