C14H30N2O4S — CID 65285119
6-(dipropylsulfamoylamino)-4,4-dimethylhexanoic acid (PubChem CID 65285119) has the molecular formula C14H30N2O4S and a molecular weight of 322.47 g/mol. Its IUPAC name is 6-(dipropylsulfamoylamino)-4,4-dimethylhexanoic acid.
| Compound Name | 6-(dipropylsulfamoylamino)-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65285119 |
| Molecular Formula | C14H30N2O4S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-(dipropylsulfamoylamino)-4,4-dimethylhexanoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)NCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C14H30N2O4S/c1-5-11-16(12-6-2)21(19,20)15-10-9-14(3,4)8-7-13(17)18/h15H,5-12H2,1-4H3,(H,17,18) |
| InChIKey | BVJNHBPAXUFWIE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |