C9H17F2NO4S — CID 65284819
6-(difluoromethylsulfonylamino)-4,4-dimethylhexanoic acid (PubChem CID 65284819) has the molecular formula C9H17F2NO4S and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-(difluoromethylsulfonylamino)-4,4-dimethylhexanoic acid.
| Compound Name | 6-(difluoromethylsulfonylamino)-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65284819 |
| Molecular Formula | C9H17F2NO4S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 6-(difluoromethylsulfonylamino)-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNS(=O)(=O)C(F)F)CCC(=O)O |
| InChI | InChI=1S/C9H17F2NO4S/c1-9(2,4-3-7(13)14)5-6-12-17(15,16)8(10)11/h8,12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | IWYSVEISZLEYQJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |