C19H26N2O3S — CID 113354897
tert-butyl N-[2-methoxy-4-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]carbamate (PubChem CID 113354897) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl N-[2-methoxy-4-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methoxy-4-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 113354897 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl N-[2-methoxy-4-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]carbamate |
| SMILES | COc1cc(NC(C)c2sccc2C)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N2O3S/c1-12-9-10-25-17(12)13(2)20-14-7-8-15(16(11-14)23-6)21-18(22)24-19(3,4)5/h7-11,13,20H,1-6H3,(H,21,22) |
| InChIKey | QAVGMBXDJCVXBR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |