C16H32N2 — CID 113359563
1-N-(3,3,5,5-tetramethylcyclohexyl)cyclohexane-1,3-diamine (PubChem CID 113359563) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-N-(3,3,5,5-tetramethylcyclohexyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(3,3,5,5-tetramethylcyclohexyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 113359563 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-N-(3,3,5,5-tetramethylcyclohexyl)cyclohexane-1,3-diamine |
| SMILES | CC1(C)CC(NC2CCCC(N)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2/c1-15(2)9-14(10-16(3,4)11-15)18-13-7-5-6-12(17)8-13/h12-14,18H,5-11,17H2,1-4H3 |
| InChIKey | AMNJQEWEPCJGFL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |