C18H36O2Si — CID 11335962
[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methanol (PubChem CID 11335962) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is [(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methanol.
| Compound Name | [(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methanol |
|---|---|
| PubChem CID | 11335962 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methanol |
| SMILES | CC(C)[C@@H]1CC=C(CO)[C@@]1(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-14(2)16-10-9-15(13-19)18(16,6)11-12-20-21(7,8)17(3,4)5/h9,14,16,19H,10-13H2,1-8H3/t16-,18+/m0/s1 |
| InChIKey | DVVDNSFNCFUJSM-FUHWJXTLSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|