C15H23NO2 — CID 113359807
1-(3,3,5,5-tetramethylcyclohexyl)pyrrole-2-carboxylic acid (PubChem CID 113359807) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-(3,3,5,5-tetramethylcyclohexyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-(3,3,5,5-tetramethylcyclohexyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 113359807 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-(3,3,5,5-tetramethylcyclohexyl)pyrrole-2-carboxylic acid |
| SMILES | CC1(C)CC(n2cccc2C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C15H23NO2/c1-14(2)8-11(9-15(3,4)10-14)16-7-5-6-12(16)13(17)18/h5-7,11H,8-10H2,1-4H3,(H,17,18) |
| InChIKey | WAKPATPSWOPOFX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |