C15H22N2O2 — CID 174902267
2-oxo-2-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrol-2-yl]acetaldehyde (PubChem CID 174902267) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-oxo-2-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrol-2-yl]acetaldehyde.
| Compound Name | 2-oxo-2-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrol-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 174902267 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-oxo-2-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrol-2-yl]acetaldehyde |
| SMILES | CC1(C)CC(n2cccc2C(=O)C=O)CC(C)(C)N1 |
| InChI | InChI=1S/C15H22N2O2/c1-14(2)8-11(9-15(3,4)16-14)17-7-5-6-12(17)13(19)10-18/h5-7,10-11,16H,8-9H2,1-4H3 |
| InChIKey | GEMZPQVXKLFXMN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|