C16H19NO4S — CID 11336214
4-[1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]pent-4-enal (PubChem CID 11336214) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-[1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]pent-4-enal.
| Compound Name | 4-[1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]pent-4-enal |
|---|---|
| PubChem CID | 11336214 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-[1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]pent-4-enal |
| SMILES | C=C(CCC=O)C1CCC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-12-5-7-14(8-6-12)22(20,21)17-15(9-10-16(17)19)13(2)4-3-11-18/h5-8,11,15H,2-4,9-10H2,1H3 |
| InChIKey | HLILBRXCHVSOIG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|