C20H19N3O2 — CID 11336543
1-(5-oxo-6,11-dihydroindeno[1,2-c]isoquinolin-9-yl)-3-propylurea (PubChem CID 11336543) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-(5-oxo-6,11-dihydroindeno[1,2-c]isoquinolin-9-yl)-3-propylurea.
| Compound Name | 1-(5-oxo-6,11-dihydroindeno[1,2-c]isoquinolin-9-yl)-3-propylurea |
|---|---|
| PubChem CID | 11336543 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(5-oxo-6,11-dihydroindeno[1,2-c]isoquinolin-9-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc2c(c1)Cc1c-2[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H19N3O2/c1-2-9-21-20(25)22-13-7-8-14-12(10-13)11-17-15-5-3-4-6-16(15)19(24)23-18(14)17/h3-8,10H,2,9,11H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | KMAAIUMLIPAUFN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |