C9H5ClF3N3O2S — CID 113366203
4-methyl-5-(3,4,5-trifluorophenyl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 113366203) has the molecular formula C9H5ClF3N3O2S and a molecular weight of 311.67 g/mol. Its IUPAC name is 4-methyl-5-(3,4,5-trifluorophenyl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-methyl-5-(3,4,5-trifluorophenyl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 113366203 |
| Molecular Formula | C9H5ClF3N3O2S |
| Molecular Weight | 311.67 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 4-methyl-5-(3,4,5-trifluorophenyl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | Cn1c(-c2cc(F)c(F)c(F)c2)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H5ClF3N3O2S/c1-16-8(14-15-9(16)19(10,17)18)4-2-5(11)7(13)6(12)3-4/h2-3H,1H3 |
| InChIKey | QLRVUDNFVDIQMS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|