C11H16N4O2S2 — CID 113366364
4-tert-butyl-5-(thiophen-3-ylmethyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 113366364) has the molecular formula C11H16N4O2S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-tert-butyl-5-(thiophen-3-ylmethyl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-tert-butyl-5-(thiophen-3-ylmethyl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 113366364 |
| Molecular Formula | C11H16N4O2S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-tert-butyl-5-(thiophen-3-ylmethyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)(C)n1c(Cc2ccsc2)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N4O2S2/c1-11(2,3)15-9(6-8-4-5-18-7-8)13-14-10(15)19(12,16)17/h4-5,7H,6H2,1-3H3,(H2,12,16,17) |
| InChIKey | IOTWFIJUPGJVBK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |