C10H13N3S — CID 115395118
4-propyl-3-(thiophen-3-ylmethyl)-1,2,4-triazole (PubChem CID 115395118) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 4-propyl-3-(thiophen-3-ylmethyl)-1,2,4-triazole.
| Compound Name | 4-propyl-3-(thiophen-3-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115395118 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-propyl-3-(thiophen-3-ylmethyl)-1,2,4-triazole |
| SMILES | CCCn1cnnc1Cc1ccsc1 |
| InChI | InChI=1S/C10H13N3S/c1-2-4-13-8-11-12-10(13)6-9-3-5-14-7-9/h3,5,7-8H,2,4,6H2,1H3 |
| InChIKey | HBSPRFJZPVFDKW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |