C13H22N2O2S — CID 113369963
2-methyl-2-[2-(4-methylpentylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 113369963) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-methyl-2-[2-(4-methylpentylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 2-methyl-2-[2-(4-methylpentylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 113369963 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-methyl-2-[2-(4-methylpentylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC(C)CCCNc1nc(C(C)(C)C(=O)O)cs1 |
| InChI | InChI=1S/C13H22N2O2S/c1-9(2)6-5-7-14-12-15-10(8-18-12)13(3,4)11(16)17/h8-9H,5-7H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | VOWFTYQYOAYACT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|