C14H24N2O2 — CID 113370615
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1-(3,4-dihydro-2H-pyran-5-yl)-N-methylmethanamine (PubChem CID 113370615) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1-(3,4-dihydro-2H-pyran-5-yl)-N-methylmethanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1-(3,4-dihydro-2H-pyran-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 113370615 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1-(3,4-dihydro-2H-pyran-5-yl)-N-methylmethanamine |
| SMILES | CNC(C1=COCCC1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H24N2O2/c1-15-14(11-4-3-7-17-9-11)13-8-16-6-2-5-12(16)10-18-13/h9,12-15H,2-8,10H2,1H3 |
| InChIKey | JCRAZYMQCBCDIN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |