About 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol
6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol (PubChem CID 113373334) has the molecular formula C11H15N5O
and a molecular weight of 233.28 g/mol. Its IUPAC name is 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol |
| PubChem CID | 113373334 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol |
| SMILES | CCn1cnnc1CNCc1ccc(O)cn1 |
| InChI | InChI=1S/C11H15N5O/c1-2-16-8-14-15-11(16)7-12-5-9-3-4-10(17)6-13-9/h3-4,6,8,12,17H,2,5,7H2,1H3 |
| InChIKey | BDKCHRHWSBSMDA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol?
The IUPAC name of 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol (CID 113373334) is 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol.
What is the SMILES notation for 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol?
The canonical SMILES for 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol is CCn1cnnc1CNCc1ccc(O)cn1.
What is the InChIKey of 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol?
The InChIKey is BDKCHRHWSBSMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c1-2-16-8-14-15-11(16)7-12-5-9-3-4-10(17)6-13-9/h3-4,6,8,12,17H,2,5,7H2,1H3.
What are the key properties of 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol?
6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol has a molecular weight of 233.28 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]pyridin-3-ol is sourced from PubChem (CID 113373334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).