C10H12F2N2O2S — CID 113373827
3,5-difluoro-N'-hydroxy-4-(1-hydroxypropan-2-ylsulfanyl)benzenecarboximidamide (PubChem CID 113373827) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 3,5-difluoro-N'-hydroxy-4-(1-hydroxypropan-2-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-N'-hydroxy-4-(1-hydroxypropan-2-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 113373827 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3,5-difluoro-N'-hydroxy-4-(1-hydroxypropan-2-ylsulfanyl)benzenecarboximidamide |
| SMILES | CC(CO)Sc1c(F)cc(C(N)=NO)cc1F |
| InChI | InChI=1S/C10H12F2N2O2S/c1-5(4-15)17-9-7(11)2-6(3-8(9)12)10(13)14-16/h2-3,5,15-16H,4H2,1H3,(H2,13,14) |
| InChIKey | UQJTXURNFLVFQF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|