C10H8F2N4OS2 — CID 81283248
3,5-difluoro-N'-hydroxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide (PubChem CID 81283248) has the molecular formula C10H8F2N4OS2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3,5-difluoro-N'-hydroxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 3,5-difluoro-N'-hydroxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 81283248 |
| Molecular Formula | C10H8F2N4OS2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3,5-difluoro-N'-hydroxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cc1nsc(Sc2c(F)cc(C(N)=NO)cc2F)n1 |
| InChI | InChI=1S/C10H8F2N4OS2/c1-4-14-10(19-16-4)18-8-6(11)2-5(3-7(8)12)9(13)15-17/h2-3,17H,1H3,(H2,13,15) |
| InChIKey | HUKOVAFDUGTDHR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|