About 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid
3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid (PubChem CID 113374865) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid.
Analyze 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid?
The IUPAC name of 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid (CID 113374865) is 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid?
The canonical SMILES for 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid is COC(C)c1nnnn1C(CC(=O)O)C(C)(C)C.
What is the InChIKey of 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid?
The InChIKey is UKZNJZHYUJJKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c1-7(18-5)10-12-13-14-15(10)8(6-9(16)17)11(2,3)4/h7-8H,6H2,1-5H3,(H,16,17).
What are the key properties of 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid?
3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid has a molecular weight of 256.31 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1-methoxyethyl)tetrazol-1-yl]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 113374865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).