C12H16N6O2 — CID 104673113
4,4-dimethyl-3-(5-pyridazin-4-yltetrazol-1-yl)pentanoic acid (PubChem CID 104673113) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4,4-dimethyl-3-(5-pyridazin-4-yltetrazol-1-yl)pentanoic acid.
| Compound Name | 4,4-dimethyl-3-(5-pyridazin-4-yltetrazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 104673113 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4,4-dimethyl-3-(5-pyridazin-4-yltetrazol-1-yl)pentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)n1nnnc1-c1ccnnc1 |
| InChI | InChI=1S/C12H16N6O2/c1-12(2,3)9(6-10(19)20)18-11(15-16-17-18)8-4-5-13-14-7-8/h4-5,7,9H,6H2,1-3H3,(H,19,20) |
| InChIKey | ZLPAPYHZGVYTGH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |