C13H17N5O2 — CID 106754449
3-[5-(2-methyl-4-pyridinyl)tetrazol-1-yl]hexanoic acid (PubChem CID 106754449) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[5-(2-methyl-4-pyridinyl)tetrazol-1-yl]hexanoic acid.
| Compound Name | 3-[5-(2-methyl-4-pyridinyl)tetrazol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 106754449 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-[5-(2-methyl-4-pyridinyl)tetrazol-1-yl]hexanoic acid |
| SMILES | CCCC(CC(=O)O)n1nnnc1-c1ccnc(C)c1 |
| InChI | InChI=1S/C13H17N5O2/c1-3-4-11(8-12(19)20)18-13(15-16-17-18)10-5-6-14-9(2)7-10/h5-7,11H,3-4,8H2,1-2H3,(H,19,20) |
| InChIKey | VAOZVWCZZVEJAS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |