C10H10Cl2N4O2S — CID 107967102
3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]pentanoic acid (PubChem CID 107967102) has the molecular formula C10H10Cl2N4O2S and a molecular weight of 321.19 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]pentanoic acid.
| Compound Name | 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 107967102 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)n1nnnc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H10Cl2N4O2S/c1-2-5(3-8(17)18)16-10(13-14-15-16)6-4-7(11)19-9(6)12/h4-5H,2-3H2,1H3,(H,17,18) |
| InChIKey | WZEPJVOAHRRQRX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |