C13H17BrN4O3 — CID 106856440
3-[5-(2-bromofuran-3-yl)tetrazol-1-yl]-5,5-dimethylhexanoic acid (PubChem CID 106856440) has the molecular formula C13H17BrN4O3 and a molecular weight of 357.21 g/mol. Its IUPAC name is 3-[5-(2-bromofuran-3-yl)tetrazol-1-yl]-5,5-dimethylhexanoic acid.
| Compound Name | 3-[5-(2-bromofuran-3-yl)tetrazol-1-yl]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106856440 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3-[5-(2-bromofuran-3-yl)tetrazol-1-yl]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)n1nnnc1-c1ccoc1Br |
| InChI | InChI=1S/C13H17BrN4O3/c1-13(2,3)7-8(6-10(19)20)18-12(15-16-17-18)9-4-5-21-11(9)14/h4-5,8H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | KPIAIASITPLEBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |