C13H15ClN4O2 — CID 106864525
3-[5-(2-chloro-4-methylphenyl)tetrazol-1-yl]pentanoic acid (PubChem CID 106864525) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-[5-(2-chloro-4-methylphenyl)tetrazol-1-yl]pentanoic acid.
| Compound Name | 3-[5-(2-chloro-4-methylphenyl)tetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 106864525 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[5-(2-chloro-4-methylphenyl)tetrazol-1-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)n1nnnc1-c1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H15ClN4O2/c1-3-9(7-12(19)20)18-13(15-16-17-18)10-5-4-8(2)6-11(10)14/h4-6,9H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | WYADQLLHYQMUAZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |