C9H11N5O2S2 — CID 113383152
5-amino-N-(2-pyridin-3-ylethyl)-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 113383152) has the molecular formula C9H11N5O2S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-amino-N-(2-pyridin-3-ylethyl)-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-amino-N-(2-pyridin-3-ylethyl)-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 113383152 |
| Molecular Formula | C9H11N5O2S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-amino-N-(2-pyridin-3-ylethyl)-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Nc1nnc(S(=O)(=O)NCCc2cccnc2)s1 |
| InChI | InChI=1S/C9H11N5O2S2/c10-8-13-14-9(17-8)18(15,16)12-5-3-7-2-1-4-11-6-7/h1-2,4,6,12H,3,5H2,(H2,10,13) |
| InChIKey | WICFTIOAMNZHIU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |