C15H16BrNO — CID 113383682
2-[(3-bromophenyl)-hydroxymethyl]bicyclo[2.2.1]heptane-2-carbonitrile (PubChem CID 113383682) has the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-[(3-bromophenyl)-hydroxymethyl]bicyclo[2.2.1]heptane-2-carbonitrile.
| Compound Name | 2-[(3-bromophenyl)-hydroxymethyl]bicyclo[2.2.1]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 113383682 |
| Molecular Formula | C15H16BrNO |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-[(3-bromophenyl)-hydroxymethyl]bicyclo[2.2.1]heptane-2-carbonitrile |
| SMILES | N#CC1(C(O)c2cccc(Br)c2)CC2CCC1C2 |
| InChI | InChI=1S/C15H16BrNO/c16-13-3-1-2-11(7-13)14(18)15(9-17)8-10-4-5-12(15)6-10/h1-3,7,10,12,14,18H,4-6,8H2 |
| InChIKey | WGYUIBGFGPMVPP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |