C18H26BrNO — CID 63522562
N-[[2-[(3-bromophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]-2-methoxyethanamine (PubChem CID 63522562) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is N-[[2-[(3-bromophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-[(3-bromophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63522562 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[[2-[(3-bromophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1(Cc2cccc(Br)c2)CC2CCC1C2 |
| InChI | InChI=1S/C18H26BrNO/c1-21-8-7-20-13-18(12-15-5-6-16(18)9-15)11-14-3-2-4-17(19)10-14/h2-4,10,15-16,20H,5-9,11-13H2,1H3 |
| InChIKey | PIHCSYFPWJBNRK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|