C18H23BrFN — CID 79697122
N-[[2-[(3-bromo-5-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine (PubChem CID 79697122) has the molecular formula C18H23BrFN and a molecular weight of 352.29 g/mol. Its IUPAC name is N-[[2-[(3-bromo-5-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(3-bromo-5-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79697122 |
| Molecular Formula | C18H23BrFN |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[[2-[(3-bromo-5-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Br)cc(CC2(CNC3CC3)CC3CCC2C3)c1 |
| InChI | InChI=1S/C18H23BrFN/c19-15-6-13(7-16(20)8-15)10-18(11-21-17-3-4-17)9-12-1-2-14(18)5-12/h6-8,12,14,17,21H,1-5,9-11H2 |
| InChIKey | BNIQXVGRTSAVIZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |