C16H22ClNS — CID 63522529
N-[[2-[(5-chlorothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine (PubChem CID 63522529) has the molecular formula C16H22ClNS and a molecular weight of 295.88 g/mol. Its IUPAC name is N-[[2-[(5-chlorothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(5-chlorothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63522529 |
| Molecular Formula | C16H22ClNS |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[[2-[(5-chlorothiophen-2-yl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
| SMILES | Clc1ccc(CC2(CNC3CC3)CC3CCC2C3)s1 |
| InChI | InChI=1S/C16H22ClNS/c17-15-6-5-14(19-15)9-16(10-18-13-3-4-13)8-11-1-2-12(16)7-11/h5-6,11-13,18H,1-4,7-10H2 |
| InChIKey | DQQZWAWKHSEXHS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |