C18H23ClFN — CID 115984206
N-[[2-[(2-chloro-3-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine (PubChem CID 115984206) has the molecular formula C18H23ClFN and a molecular weight of 307.84 g/mol. Its IUPAC name is N-[[2-[(2-chloro-3-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(2-chloro-3-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115984206 |
| Molecular Formula | C18H23ClFN |
| Molecular Weight | 307.84 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[[2-[(2-chloro-3-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
| SMILES | Fc1cccc(CC2(CNC3CC3)CC3CCC2C3)c1Cl |
| InChI | InChI=1S/C18H23ClFN/c19-17-13(2-1-3-16(17)20)10-18(11-21-15-6-7-15)9-12-4-5-14(18)8-12/h1-3,12,14-15,21H,4-11H2 |
| InChIKey | ZELJEFXVNKFNFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |