C18H25ClFN — CID 63522524
N-[[2-[(2-chloro-4-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine (PubChem CID 63522524) has the molecular formula C18H25ClFN and a molecular weight of 309.86 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63522524 |
| Molecular Formula | C18H25ClFN |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(Cc2ccc(F)cc2Cl)CC2CCC1C2 |
| InChI | InChI=1S/C18H25ClFN/c1-12(2)21-11-18(9-13-3-5-15(18)7-13)10-14-4-6-16(20)8-17(14)19/h4,6,8,12-13,15,21H,3,5,7,9-11H2,1-2H3 |
| InChIKey | PDHVKBBRCXDITR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |