C17H22INO2 — CID 11338514
methyl (1R,2S,3S,5R,7R)-3-(4-iodophenyl)-7,8-dimethyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 11338514) has the molecular formula C17H22INO2 and a molecular weight of 399.27 g/mol. Its IUPAC name is methyl (1R,2S,3S,5R,7R)-3-(4-iodophenyl)-7,8-dimethyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,5R,7R)-3-(4-iodophenyl)-7,8-dimethyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 11338514 |
| Molecular Formula | C17H22INO2 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | methyl (1R,2S,3S,5R,7R)-3-(4-iodophenyl)-7,8-dimethyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@H](C)C[C@@H](C[C@@H]1c1ccc(I)cc1)N2C |
| InChI | InChI=1S/C17H22INO2/c1-10-8-13-9-14(11-4-6-12(18)7-5-11)15(17(20)21-3)16(10)19(13)2/h4-7,10,13-16H,8-9H2,1-3H3/t10-,13+,14-,15+,16-/m1/s1 |
| InChIKey | UXFFAYZLHBWLCG-NFWSPEMXSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|