C18H23BrN4O2 — CID 11338740
2-N-(2-bromophenyl)-4-N-butyl-4-N-ethyl-6-methyl-3-nitropyridine-2,4-diamine (PubChem CID 11338740) has the molecular formula C18H23BrN4O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-N-(2-bromophenyl)-4-N-butyl-4-N-ethyl-6-methyl-3-nitropyridine-2,4-diamine.
| Compound Name | 2-N-(2-bromophenyl)-4-N-butyl-4-N-ethyl-6-methyl-3-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 11338740 |
| Molecular Formula | C18H23BrN4O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-N-(2-bromophenyl)-4-N-butyl-4-N-ethyl-6-methyl-3-nitropyridine-2,4-diamine |
| SMILES | CCCCN(CC)c1cc(C)nc(Nc2ccccc2Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23BrN4O2/c1-4-6-11-22(5-2)16-12-13(3)20-18(17(16)23(24)25)21-15-10-8-7-9-14(15)19/h7-10,12H,4-6,11H2,1-3H3,(H,20,21) |
| InChIKey | LXTQSRNCRIRRRQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|