C23H33N5O5 — CID 11385618
ethyl 2-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]-(6-methoxy-2-methyl-3-pyridinyl)amino]acetate (PubChem CID 11385618) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is ethyl 2-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]-(6-methoxy-2-methyl-3-pyridinyl)amino]acetate.
| Compound Name | ethyl 2-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]-(6-methoxy-2-methyl-3-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 11385618 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | ethyl 2-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]-(6-methoxy-2-methyl-3-pyridinyl)amino]acetate |
| SMILES | CCCCN(CC)c1cc(C)nc(N(CC(=O)OCC)c2ccc(OC)nc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H33N5O5/c1-7-10-13-26(8-2)19-14-16(4)24-23(22(19)28(30)31)27(15-21(29)33-9-3)18-11-12-20(32-6)25-17(18)5/h11-12,14H,7-10,13,15H2,1-6H3 |
| InChIKey | AKQWJUDNCMVGAV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|