C20H28N4O3 — CID 11440195
4-N-butyl-4-N-ethyl-2-N-(4-methoxy-2-methylphenyl)-6-methyl-3-nitropyridine-2,4-diamine (PubChem CID 11440195) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-N-butyl-4-N-ethyl-2-N-(4-methoxy-2-methylphenyl)-6-methyl-3-nitropyridine-2,4-diamine.
| Compound Name | 4-N-butyl-4-N-ethyl-2-N-(4-methoxy-2-methylphenyl)-6-methyl-3-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 11440195 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-N-butyl-4-N-ethyl-2-N-(4-methoxy-2-methylphenyl)-6-methyl-3-nitropyridine-2,4-diamine |
| SMILES | CCCCN(CC)c1cc(C)nc(Nc2ccc(OC)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28N4O3/c1-6-8-11-23(7-2)18-13-15(4)21-20(19(18)24(25)26)22-17-10-9-16(27-5)12-14(17)3/h9-10,12-13H,6-8,11H2,1-5H3,(H,21,22) |
| InChIKey | QPQIMNUOABLTSH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|