C19H25N3O7 — CID 11338742
[(3aS,5R,6S,7R,7aR)-6,7-diacetyloxy-3-benzyl-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-5-yl]methyl acetate (PubChem CID 11338742) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is [(3aS,5R,6S,7R,7aR)-6,7-diacetyloxy-3-benzyl-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-5-yl]methyl acetate.
| Compound Name | [(3aS,5R,6S,7R,7aR)-6,7-diacetyloxy-3-benzyl-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 11338742 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [(3aS,5R,6S,7R,7aR)-6,7-diacetyloxy-3-benzyl-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2[C@H](NNN2Cc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H25N3O7/c1-11(23)26-10-15-17(27-12(2)24)18(28-13(3)25)16-19(29-15)22(21-20-16)9-14-7-5-4-6-8-14/h4-8,15-21H,9-10H2,1-3H3/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | GRCHSUNFWCWNOW-NNIGNNQHSA-N |
| XLogP | 0.03 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|