C19H24N4O7 — CID 11373507
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(benzylamino)oxan-2-yl]methyl acetate (PubChem CID 11373507) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(benzylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(benzylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11373507 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-azido-5-(benzylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N=[N+]=[N-])[C@H](NCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24N4O7/c1-11(24)27-10-15-17(28-12(2)25)18(29-13(3)26)16(19(30-15)22-23-20)21-9-14-7-5-4-6-8-14/h4-8,15-19,21H,9-10H2,1-3H3/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | JNWJCNPNZOCBHD-FVVUREQNSA-N |
| XLogP | 1.61 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|