C21H12FNO5S — CID 11338805
1-(benzenesulfonyl)-2-(3-fluorobenzoyl)indole-4,7-dione (PubChem CID 11338805) has the molecular formula C21H12FNO5S and a molecular weight of 409.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(3-fluorobenzoyl)indole-4,7-dione.
| Compound Name | 1-(benzenesulfonyl)-2-(3-fluorobenzoyl)indole-4,7-dione |
|---|---|
| PubChem CID | 11338805 |
| Molecular Formula | C21H12FNO5S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(3-fluorobenzoyl)indole-4,7-dione |
| SMILES | O=C1C=CC(=O)c2c1cc(C(=O)c1cccc(F)c1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H12FNO5S/c22-14-6-4-5-13(11-14)21(26)17-12-16-18(24)9-10-19(25)20(16)23(17)29(27,28)15-7-2-1-3-8-15/h1-12H |
| InChIKey | ZVBWXERYMILLPI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|