C11H9FN2O3 — CID 113389395
6-(2-fluoro-6-methoxyphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 113389395) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 6-(2-fluoro-6-methoxyphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(2-fluoro-6-methoxyphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113389395 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 6-(2-fluoro-6-methoxyphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | COc1cccc(F)c1-c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H9FN2O3/c1-17-8-4-2-3-6(12)10(8)7-5-9(15)14-11(16)13-7/h2-5H,1H3,(H2,13,14,15,16) |
| InChIKey | NUKVGPQEDYWKHM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |