C14H17BrN4 — CID 113394506
3-bromo-8-(3,4-dimethylpiperazin-1-yl)-1,5-naphthyridine (PubChem CID 113394506) has the molecular formula C14H17BrN4 and a molecular weight of 321.22 g/mol. Its IUPAC name is 3-bromo-8-(3,4-dimethylpiperazin-1-yl)-1,5-naphthyridine.
| Compound Name | 3-bromo-8-(3,4-dimethylpiperazin-1-yl)-1,5-naphthyridine |
|---|---|
| PubChem CID | 113394506 |
| Molecular Formula | C14H17BrN4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-bromo-8-(3,4-dimethylpiperazin-1-yl)-1,5-naphthyridine |
| SMILES | CC1CN(c2ccnc3cc(Br)cnc23)CCN1C |
| InChI | InChI=1S/C14H17BrN4/c1-10-9-19(6-5-18(10)2)13-3-4-16-12-7-11(15)8-17-14(12)13/h3-4,7-8,10H,5-6,9H2,1-2H3 |
| InChIKey | GZBXQMXHPNIGRA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |