C13H23N3O2 — CID 113394722
2-[(2-hydroxy-3-pyrazol-1-ylpropyl)amino]cycloheptan-1-ol (PubChem CID 113394722) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-pyrazol-1-ylpropyl)amino]cycloheptan-1-ol.
| Compound Name | 2-[(2-hydroxy-3-pyrazol-1-ylpropyl)amino]cycloheptan-1-ol |
|---|---|
| PubChem CID | 113394722 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[(2-hydroxy-3-pyrazol-1-ylpropyl)amino]cycloheptan-1-ol |
| SMILES | OC(CNC1CCCCCC1O)Cn1cccn1 |
| InChI | InChI=1S/C13H23N3O2/c17-11(10-16-8-4-7-15-16)9-14-12-5-2-1-3-6-13(12)18/h4,7-8,11-14,17-18H,1-3,5-6,9-10H2 |
| InChIKey | MBBCMGCYRXGTNP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |