C16H30N4O — CID 60980033
1-[3-[cyclohexyl(methyl)amino]propylamino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 60980033) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-[3-[cyclohexyl(methyl)amino]propylamino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 1-[3-[cyclohexyl(methyl)amino]propylamino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 60980033 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 1-[3-[cyclohexyl(methyl)amino]propylamino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CN(CCCNCC(O)Cn1cccn1)C1CCCCC1 |
| InChI | InChI=1S/C16H30N4O/c1-19(15-7-3-2-4-8-15)11-5-9-17-13-16(21)14-20-12-6-10-18-20/h6,10,12,15-17,21H,2-5,7-9,11,13-14H2,1H3 |
| InChIKey | HOFFKCGBXANGBI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|