C15H19Cl2NO — CID 113403675
1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-(chloromethyl)piperidine (PubChem CID 113403675) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-(chloromethyl)piperidine.
| Compound Name | 1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-(chloromethyl)piperidine |
|---|---|
| PubChem CID | 113403675 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-(chloromethyl)piperidine |
| SMILES | ClCC1CCN(Cc2cc(Cl)cc3c2OCC3)CC1 |
| InChI | InChI=1S/C15H19Cl2NO/c16-9-11-1-4-18(5-2-11)10-13-8-14(17)7-12-3-6-19-15(12)13/h7-8,11H,1-6,9-10H2 |
| InChIKey | OVOMSGUOIREQAH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|