About 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide
2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide (PubChem CID 113405792) has the molecular formula C12H22N6O
and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide |
| PubChem CID | 113405792 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide |
| SMILES | Cc1nc(NN)c(C)c(NCC(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C12H22N6O/c1-7(2)5-14-10(19)6-15-11-8(3)12(18-13)17-9(4)16-11/h7H,5-6,13H2,1-4H3,(H,14,19)(H2,15,16,17,18) |
| InChIKey | RWOGEUCCUCMSLF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide?
The IUPAC name of 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide (CID 113405792) is 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide.
What is the SMILES notation for 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide?
The canonical SMILES for 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide is Cc1nc(NN)c(C)c(NCC(=O)NCC(C)C)n1.
What is the InChIKey of 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide?
The InChIKey is RWOGEUCCUCMSLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N6O/c1-7(2)5-14-10(19)6-15-11-8(3)12(18-13)17-9(4)16-11/h7H,5-6,13H2,1-4H3,(H,14,19)(H2,15,16,17,18).
What are the key properties of 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide?
2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide has a molecular weight of 266.35 g/mol, XLogP of 0.56, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-N-(2-methylpropyl)acetamide is sourced from PubChem (CID 113405792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).