C25H33N5O5 — CID 11340666
5-[1-[(3-heptylphenyl)methyl]triazol-4-yl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 11340666) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-[1-[(3-heptylphenyl)methyl]triazol-4-yl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[1-[(3-heptylphenyl)methyl]triazol-4-yl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11340666 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 5-[1-[(3-heptylphenyl)methyl]triazol-4-yl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCCc1cccc(Cn2cc(-c3cn([C@H]4C[C@H](O)[C@@H](CO)O4)c(=O)[nH]c3=O)nn2)c1 |
| InChI | InChI=1S/C25H33N5O5/c1-2-3-4-5-6-8-17-9-7-10-18(11-17)13-29-15-20(27-28-29)19-14-30(25(34)26-24(19)33)23-12-21(32)22(16-31)35-23/h7,9-11,14-15,21-23,31-32H,2-6,8,12-13,16H2,1H3,(H,26,33,34)/t21-,22+,23+/m0/s1 |
| InChIKey | ZOWVLPAPULBXCH-YTFSRNRJSA-N |
| XLogP | 2.00 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|