C14H22ClFN2 — CID 113409083
N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 113409083) has the molecular formula C14H22ClFN2 and a molecular weight of 272.79 g/mol. Its IUPAC name is N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-N-propylethane-1,2-diamine.
| Compound Name | N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 113409083 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)CCc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H22ClFN2/c1-3-8-17-9-11-18(2)10-7-12-13(15)5-4-6-14(12)16/h4-6,17H,3,7-11H2,1-2H3 |
| InChIKey | QONUEULZHFYYPJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|