C30H46O4Si — CID 11340979
(3R,5S)-5,7-bis(phenylmethoxy)-3-tri(propan-2-yl)silyloxyheptanal (PubChem CID 11340979) has the molecular formula C30H46O4Si and a molecular weight of 498.78 g/mol. Its IUPAC name is (3R,5S)-5,7-bis(phenylmethoxy)-3-tri(propan-2-yl)silyloxyheptanal.
| Compound Name | (3R,5S)-5,7-bis(phenylmethoxy)-3-tri(propan-2-yl)silyloxyheptanal |
|---|---|
| PubChem CID | 11340979 |
| Molecular Formula | C30H46O4Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | (3R,5S)-5,7-bis(phenylmethoxy)-3-tri(propan-2-yl)silyloxyheptanal |
| SMILES | CC(C)[Si](O[C@@H](CC=O)C[C@H](CCOCc1ccccc1)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H46O4Si/c1-24(2)35(25(3)4,26(5)6)34-30(17-19-31)21-29(33-23-28-15-11-8-12-16-28)18-20-32-22-27-13-9-7-10-14-27/h7-16,19,24-26,29-30H,17-18,20-23H2,1-6H3/t29-,30-/m0/s1 |
| InChIKey | MUJROVSBJXUCQV-KYJUHHDHSA-N |
| XLogP | 7.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|